C23H23N3O3S — CID 55904243
N-[3-[[2-(4-methoxyphenyl)sulfanylpropanoylamino]methyl]phenyl]pyridine-4-carboxamide (PubChem CID 55904243) has the molecular formula C23H23N3O3S and a molecular weight of 421.52 g/mol. Its IUPAC name is N-[3-[[2-(4-methoxyphenyl)sulfanylpropanoylamino]methyl]phenyl]pyridine-4-carboxamide.
| Compound Name | N-[3-[[2-(4-methoxyphenyl)sulfanylpropanoylamino]methyl]phenyl]pyridine-4-carboxamide |
|---|---|
| PubChem CID | 55904243 |
| Molecular Formula | C23H23N3O3S |
| Molecular Weight | 421.52 g/mol |
| Exact Mass | 421.15 |
| IUPAC Name | N-[3-[[2-(4-methoxyphenyl)sulfanylpropanoylamino]methyl]phenyl]pyridine-4-carboxamide |
| SMILES | COc1ccc(SC(C)C(=O)NCc2cccc(NC(=O)c3ccncc3)c2)cc1 |
| InChI | InChI=1S/C23H23N3O3S/c1-16(30-21-8-6-20(29-2)7-9-21)22(27)25-15-17-4-3-5-19(14-17)26-23(28)18-10-12-24-13-11-18/h3-14,16H,15H2,1-2H3,(H,25,27)(H,26,28) |
| InChIKey | YYYKCSFLYMFBBH-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 80.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.52 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |