C17H31N3O4S2 — CID 55904290
2-[(dibutylsulfamoylamino)methyl]-N,N-dimethylbenzenesulfonamide (PubChem CID 55904290) has the molecular formula C17H31N3O4S2 and a molecular weight of 405.59 g/mol. Its IUPAC name is 2-[(dibutylsulfamoylamino)methyl]-N,N-dimethylbenzenesulfonamide.
| Compound Name | 2-[(dibutylsulfamoylamino)methyl]-N,N-dimethylbenzenesulfonamide |
|---|---|
| PubChem CID | 55904290 |
| Molecular Formula | C17H31N3O4S2 |
| Molecular Weight | 405.59 g/mol |
| Exact Mass | 405.18 |
| IUPAC Name | 2-[(dibutylsulfamoylamino)methyl]-N,N-dimethylbenzenesulfonamide |
| SMILES | CCCCN(CCCC)S(=O)(=O)NCc1ccccc1S(=O)(=O)N(C)C |
| InChI | InChI=1S/C17H31N3O4S2/c1-5-7-13-20(14-8-6-2)26(23,24)18-15-16-11-9-10-12-17(16)25(21,22)19(3)4/h9-12,18H,5-8,13-15H2,1-4H3 |
| InChIKey | UTCWAEXMUIMGKB-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 86.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.59 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |