About methyl 2-[(7-fluoro-2-oxo-3,4-dihydro-1H-quinolin-6-yl)sulfonyl-propylamino]acetate
methyl 2-[(7-fluoro-2-oxo-3,4-dihydro-1H-quinolin-6-yl)sulfonyl-propylamino]acetate (PubChem CID 55905067) has the molecular formula C15H19FN2O5S
and a molecular weight of 358.39 g/mol. Its IUPAC name is methyl 2-[(7-fluoro-2-oxo-3,4-dihydro-1H-quinolin-6-yl)sulfonyl-propylamino]acetate.
Molecular Properties
| Compound Name | methyl 2-[(7-fluoro-2-oxo-3,4-dihydro-1H-quinolin-6-yl)sulfonyl-propylamino]acetate |
| PubChem CID | 55905067 |
| Molecular Formula | C15H19FN2O5S |
| Molecular Weight | 358.39 g/mol |
| Exact Mass | 358.10 |
| IUPAC Name | methyl 2-[(7-fluoro-2-oxo-3,4-dihydro-1H-quinolin-6-yl)sulfonyl-propylamino]acetate |
| SMILES | CCCN(CC(=O)OC)S(=O)(=O)c1cc2c(cc1F)NC(=O)CC2 |
| InChI | InChI=1S/C15H19FN2O5S/c1-3-6-18(9-15(20)23-2)24(21,22)13-7-10-4-5-14(19)17-12(10)8-11(13)16/h7-8H,3-6,9H2,1-2H3,(H,17,19) |
| InChIKey | AHQHAKBFZVBJBF-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 358.39 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze methyl 2-[(7-fluoro-2-oxo-3,4-dihydro-1H-quinolin-6-yl)sulfonyl-propylamino]acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-[(7-fluoro-2-oxo-3,4-dihydro-1H-quinolin-6-yl)sulfonyl-propylamino]acetate?
The IUPAC name of methyl 2-[(7-fluoro-2-oxo-3,4-dihydro-1H-quinolin-6-yl)sulfonyl-propylamino]acetate (CID 55905067) is methyl 2-[(7-fluoro-2-oxo-3,4-dihydro-1H-quinolin-6-yl)sulfonyl-propylamino]acetate.
What is the SMILES notation for methyl 2-[(7-fluoro-2-oxo-3,4-dihydro-1H-quinolin-6-yl)sulfonyl-propylamino]acetate?
The canonical SMILES for methyl 2-[(7-fluoro-2-oxo-3,4-dihydro-1H-quinolin-6-yl)sulfonyl-propylamino]acetate is CCCN(CC(=O)OC)S(=O)(=O)c1cc2c(cc1F)NC(=O)CC2.
What is the InChIKey of methyl 2-[(7-fluoro-2-oxo-3,4-dihydro-1H-quinolin-6-yl)sulfonyl-propylamino]acetate?
The InChIKey is AHQHAKBFZVBJBF-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H19FN2O5S/c1-3-6-18(9-15(20)23-2)24(21,22)13-7-10-4-5-14(19)17-12(10)8-11(13)16/h7-8H,3-6,9H2,1-2H3,(H,17,19).
What are the key properties of methyl 2-[(7-fluoro-2-oxo-3,4-dihydro-1H-quinolin-6-yl)sulfonyl-propylamino]acetate?
methyl 2-[(7-fluoro-2-oxo-3,4-dihydro-1H-quinolin-6-yl)sulfonyl-propylamino]acetate has a molecular weight of 358.39 g/mol, XLogP of 1.28, 6 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-[(7-fluoro-2-oxo-3,4-dihydro-1H-quinolin-6-yl)sulfonyl-propylamino]acetate is sourced from PubChem (CID 55905067), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).