C18H15BrClN3O2 — CID 55905390
N-(5-bromo-2-methoxyphenyl)-1-(3-chlorophenyl)-5-methylpyrazole-4-carboxamide (PubChem CID 55905390) has the molecular formula C18H15BrClN3O2 and a molecular weight of 420.69 g/mol. Its IUPAC name is N-(5-bromo-2-methoxyphenyl)-1-(3-chlorophenyl)-5-methylpyrazole-4-carboxamide.
| Compound Name | N-(5-bromo-2-methoxyphenyl)-1-(3-chlorophenyl)-5-methylpyrazole-4-carboxamide |
|---|---|
| PubChem CID | 55905390 |
| Molecular Formula | C18H15BrClN3O2 |
| Molecular Weight | 420.69 g/mol |
| Exact Mass | 419.00 |
| IUPAC Name | N-(5-bromo-2-methoxyphenyl)-1-(3-chlorophenyl)-5-methylpyrazole-4-carboxamide |
| SMILES | COc1ccc(Br)cc1NC(=O)c1cnn(-c2cccc(Cl)c2)c1C |
| InChI | InChI=1S/C18H15BrClN3O2/c1-11-15(10-21-23(11)14-5-3-4-13(20)9-14)18(24)22-16-8-12(19)6-7-17(16)25-2/h3-10H,1-2H3,(H,22,24) |
| InChIKey | CDLZHHMDZXAQGG-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.69 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |