C20H19NO3S — CID 55905638
4-phenyl-N-(4,5,6,7-tetrahydro-1-benzofuran-4-yl)benzenesulfonamide (PubChem CID 55905638) has the molecular formula C20H19NO3S and a molecular weight of 353.44 g/mol. Its IUPAC name is 4-phenyl-N-(4,5,6,7-tetrahydro-1-benzofuran-4-yl)benzenesulfonamide.
| Compound Name | 4-phenyl-N-(4,5,6,7-tetrahydro-1-benzofuran-4-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 55905638 |
| Molecular Formula | C20H19NO3S |
| Molecular Weight | 353.44 g/mol |
| Exact Mass | 353.11 |
| IUPAC Name | 4-phenyl-N-(4,5,6,7-tetrahydro-1-benzofuran-4-yl)benzenesulfonamide |
| SMILES | O=S(=O)(NC1CCCc2occc21)c1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C20H19NO3S/c22-25(23,21-19-7-4-8-20-18(19)13-14-24-20)17-11-9-16(10-12-17)15-5-2-1-3-6-15/h1-3,5-6,9-14,19,21H,4,7-8H2 |
| InChIKey | ADAIILXFGHPIGR-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 59.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.44 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |