C17H15BrClNO2 — CID 55906811
N-(5-bromo-2-methoxyphenyl)-2-(2-chlorophenyl)cyclopropane-1-carboxamide (PubChem CID 55906811) has the molecular formula C17H15BrClNO2 and a molecular weight of 380.67 g/mol. Its IUPAC name is N-(5-bromo-2-methoxyphenyl)-2-(2-chlorophenyl)cyclopropane-1-carboxamide.
| Compound Name | N-(5-bromo-2-methoxyphenyl)-2-(2-chlorophenyl)cyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 55906811 |
| Molecular Formula | C17H15BrClNO2 |
| Molecular Weight | 380.67 g/mol |
| Exact Mass | 379.00 |
| IUPAC Name | N-(5-bromo-2-methoxyphenyl)-2-(2-chlorophenyl)cyclopropane-1-carboxamide |
| SMILES | COc1ccc(Br)cc1NC(=O)C1CC1c1ccccc1Cl |
| InChI | InChI=1S/C17H15BrClNO2/c1-22-16-7-6-10(18)8-15(16)20-17(21)13-9-12(13)11-4-2-3-5-14(11)19/h2-8,12-13H,9H2,1H3,(H,20,21) |
| InChIKey | PORBGCRXNYAMAQ-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.67 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |