C20H26N4O3S — CID 55906849
N-(3-cyano-5-ethylthiophen-2-yl)-2-(7,7,9-trimethyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)acetamide (PubChem CID 55906849) has the molecular formula C20H26N4O3S and a molecular weight of 402.52 g/mol. Its IUPAC name is N-(3-cyano-5-ethylthiophen-2-yl)-2-(7,7,9-trimethyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)acetamide.
| Compound Name | N-(3-cyano-5-ethylthiophen-2-yl)-2-(7,7,9-trimethyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)acetamide |
|---|---|
| PubChem CID | 55906849 |
| Molecular Formula | C20H26N4O3S |
| Molecular Weight | 402.52 g/mol |
| Exact Mass | 402.17 |
| IUPAC Name | N-(3-cyano-5-ethylthiophen-2-yl)-2-(7,7,9-trimethyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)acetamide |
| SMILES | CCc1cc(C#N)c(NC(=O)CN2C(=O)NC3(CC(C)CC(C)(C)C3)C2=O)s1 |
| InChI | InChI=1S/C20H26N4O3S/c1-5-14-6-13(9-21)16(28-14)22-15(25)10-24-17(26)20(23-18(24)27)8-12(2)7-19(3,4)11-20/h6,12H,5,7-8,10-11H2,1-4H3,(H,22,25)(H,23,27) |
| InChIKey | HISLSZFIRFHKSB-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 102.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.52 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|