C20H34N4O2S — CID 55906892
1-butanoyl-N-(5-octyl-1,3,4-thiadiazol-2-yl)piperidine-3-carboxamide (PubChem CID 55906892) has the molecular formula C20H34N4O2S and a molecular weight of 394.59 g/mol. Its IUPAC name is 1-butanoyl-N-(5-octyl-1,3,4-thiadiazol-2-yl)piperidine-3-carboxamide.
| Compound Name | 1-butanoyl-N-(5-octyl-1,3,4-thiadiazol-2-yl)piperidine-3-carboxamide |
|---|---|
| PubChem CID | 55906892 |
| Molecular Formula | C20H34N4O2S |
| Molecular Weight | 394.59 g/mol |
| Exact Mass | 394.24 |
| IUPAC Name | 1-butanoyl-N-(5-octyl-1,3,4-thiadiazol-2-yl)piperidine-3-carboxamide |
| SMILES | CCCCCCCCc1nnc(NC(=O)C2CCCN(C(=O)CCC)C2)s1 |
| InChI | InChI=1S/C20H34N4O2S/c1-3-5-6-7-8-9-13-17-22-23-20(27-17)21-19(26)16-12-10-14-24(15-16)18(25)11-4-2/h16H,3-15H2,1-2H3,(H,21,23,26) |
| InChIKey | CTBGWXWJDXEYQL-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 75.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.59 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|