C36H50O6S — CID 559071
tert-butyl 4-(3-acetyloxy-10,13-dimethyl-12-oxo-1,2,3,4,5,6,7,8,9,11,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-17-yl)-5-oxo-2-phenylsulfanylpentanoate (PubChem CID 559071) has the molecular formula C36H50O6S and a molecular weight of 610.86 g/mol. Its IUPAC name is tert-butyl 4-(3-acetyloxy-10,13-dimethyl-12-oxo-1,2,3,4,5,6,7,8,9,11,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-17-yl)-5-oxo-2-phenylsulfanylpentanoate.
| Compound Name | tert-butyl 4-(3-acetyloxy-10,13-dimethyl-12-oxo-1,2,3,4,5,6,7,8,9,11,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-17-yl)-5-oxo-2-phenylsulfanylpentanoate |
|---|---|
| PubChem CID | 559071 |
| Molecular Formula | C36H50O6S |
| Molecular Weight | 610.86 g/mol |
| Exact Mass | 610.33 |
| IUPAC Name | tert-butyl 4-(3-acetyloxy-10,13-dimethyl-12-oxo-1,2,3,4,5,6,7,8,9,11,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-17-yl)-5-oxo-2-phenylsulfanylpentanoate |
| SMILES | CC(=O)OC1CCC2(C)C(CCC3C2CC(=O)C2(C)C(C(C=O)CC(Sc4ccccc4)C(=O)OC(C)(C)C)CCC32)C1 |
| InChI | InChI=1S/C36H50O6S/c1-22(38)41-25-16-17-35(5)24(19-25)12-13-27-29-15-14-28(36(29,6)32(39)20-30(27)35)23(21-37)18-31(33(40)42-34(2,3)4)43-26-10-8-7-9-11-26/h7-11,21,23-25,27-31H,12-20H2,1-6H3 |
| InChIKey | UGXLCVYDSASYRU-UHFFFAOYSA-N |
| XLogP | 7.46 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 610.86 |
| LogP ≤ 5 | 7.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|