C18H20F2N2O3 — CID 55908461
N-[4-(dimethylamino)-3,5-difluorophenyl]-2-(4-methoxyphenoxy)propanamide (PubChem CID 55908461) has the molecular formula C18H20F2N2O3 and a molecular weight of 350.37 g/mol. Its IUPAC name is N-[4-(dimethylamino)-3,5-difluorophenyl]-2-(4-methoxyphenoxy)propanamide.
| Compound Name | N-[4-(dimethylamino)-3,5-difluorophenyl]-2-(4-methoxyphenoxy)propanamide |
|---|---|
| PubChem CID | 55908461 |
| Molecular Formula | C18H20F2N2O3 |
| Molecular Weight | 350.37 g/mol |
| Exact Mass | 350.14 |
| IUPAC Name | N-[4-(dimethylamino)-3,5-difluorophenyl]-2-(4-methoxyphenoxy)propanamide |
| SMILES | COc1ccc(OC(C)C(=O)Nc2cc(F)c(N(C)C)c(F)c2)cc1 |
| InChI | InChI=1S/C18H20F2N2O3/c1-11(25-14-7-5-13(24-4)6-8-14)18(23)21-12-9-15(19)17(22(2)3)16(20)10-12/h5-11H,1-4H3,(H,21,23) |
| InChIKey | YDQYZYJTBOBVFN-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.37 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|