C21H29N3O2 — CID 55908630
1-tert-butyl-3-cyclopropyl-N-[(2-propan-2-yloxyphenyl)methyl]pyrazole-5-carboxamide (PubChem CID 55908630) has the molecular formula C21H29N3O2 and a molecular weight of 355.48 g/mol. Its IUPAC name is 1-tert-butyl-3-cyclopropyl-N-[(2-propan-2-yloxyphenyl)methyl]pyrazole-5-carboxamide.
| Compound Name | 1-tert-butyl-3-cyclopropyl-N-[(2-propan-2-yloxyphenyl)methyl]pyrazole-5-carboxamide |
|---|---|
| PubChem CID | 55908630 |
| Molecular Formula | C21H29N3O2 |
| Molecular Weight | 355.48 g/mol |
| Exact Mass | 355.23 |
| IUPAC Name | 1-tert-butyl-3-cyclopropyl-N-[(2-propan-2-yloxyphenyl)methyl]pyrazole-5-carboxamide |
| SMILES | CC(C)Oc1ccccc1CNC(=O)c1cc(C2CC2)nn1C(C)(C)C |
| InChI | InChI=1S/C21H29N3O2/c1-14(2)26-19-9-7-6-8-16(19)13-22-20(25)18-12-17(15-10-11-15)23-24(18)21(3,4)5/h6-9,12,14-15H,10-11,13H2,1-5H3,(H,22,25) |
| InChIKey | AHBBCSJSYKMOTR-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.48 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |