C21H27N3O5S — CID 55909086
4-benzylsulfonyl-N-[(3,5-dimethoxyphenyl)methyl]piperazine-1-carboxamide (PubChem CID 55909086) has the molecular formula C21H27N3O5S and a molecular weight of 433.53 g/mol. Its IUPAC name is 4-benzylsulfonyl-N-[(3,5-dimethoxyphenyl)methyl]piperazine-1-carboxamide.
| Compound Name | 4-benzylsulfonyl-N-[(3,5-dimethoxyphenyl)methyl]piperazine-1-carboxamide |
|---|---|
| PubChem CID | 55909086 |
| Molecular Formula | C21H27N3O5S |
| Molecular Weight | 433.53 g/mol |
| Exact Mass | 433.17 |
| IUPAC Name | 4-benzylsulfonyl-N-[(3,5-dimethoxyphenyl)methyl]piperazine-1-carboxamide |
| SMILES | COc1cc(CNC(=O)N2CCN(S(=O)(=O)Cc3ccccc3)CC2)cc(OC)c1 |
| InChI | InChI=1S/C21H27N3O5S/c1-28-19-12-18(13-20(14-19)29-2)15-22-21(25)23-8-10-24(11-9-23)30(26,27)16-17-6-4-3-5-7-17/h3-7,12-14H,8-11,15-16H2,1-2H3,(H,22,25) |
| InChIKey | LGDBOEQALPEAJD-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 88.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.53 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |