C24H20N4O3 — CID 55909182
1-methyl-2-oxo-N-[4-(phenylcarbamoylamino)phenyl]quinoline-4-carboxamide (PubChem CID 55909182) has the molecular formula C24H20N4O3 and a molecular weight of 412.45 g/mol. Its IUPAC name is 1-methyl-2-oxo-N-[4-(phenylcarbamoylamino)phenyl]quinoline-4-carboxamide.
| Compound Name | 1-methyl-2-oxo-N-[4-(phenylcarbamoylamino)phenyl]quinoline-4-carboxamide |
|---|---|
| PubChem CID | 55909182 |
| Molecular Formula | C24H20N4O3 |
| Molecular Weight | 412.45 g/mol |
| Exact Mass | 412.15 |
| IUPAC Name | 1-methyl-2-oxo-N-[4-(phenylcarbamoylamino)phenyl]quinoline-4-carboxamide |
| SMILES | Cn1c(=O)cc(C(=O)Nc2ccc(NC(=O)Nc3ccccc3)cc2)c2ccccc21 |
| InChI | InChI=1S/C24H20N4O3/c1-28-21-10-6-5-9-19(21)20(15-22(28)29)23(30)25-17-11-13-18(14-12-17)27-24(31)26-16-7-3-2-4-8-16/h2-15H,1H3,(H,25,30)(H2,26,27,31) |
| InChIKey | JMEYPMYLMCRSQP-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 92.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.45 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |