About 1-(2,5-difluorophenyl)ethyl 2-[3,5-dimethyl-1-(2-methylpropyl)pyrazol-4-yl]acetate
1-(2,5-difluorophenyl)ethyl 2-[3,5-dimethyl-1-(2-methylpropyl)pyrazol-4-yl]acetate (PubChem CID 55909252) has the molecular formula C19H24F2N2O2
and a molecular weight of 350.41 g/mol. Its IUPAC name is 1-(2,5-difluorophenyl)ethyl 2-[3,5-dimethyl-1-(2-methylpropyl)pyrazol-4-yl]acetate.
Molecular Properties
| Compound Name | 1-(2,5-difluorophenyl)ethyl 2-[3,5-dimethyl-1-(2-methylpropyl)pyrazol-4-yl]acetate |
| PubChem CID | 55909252 |
| Molecular Formula | C19H24F2N2O2 |
| Molecular Weight | 350.41 g/mol |
| Exact Mass | 350.18 |
| IUPAC Name | 1-(2,5-difluorophenyl)ethyl 2-[3,5-dimethyl-1-(2-methylpropyl)pyrazol-4-yl]acetate |
| SMILES | Cc1nn(CC(C)C)c(C)c1CC(=O)OC(C)c1cc(F)ccc1F |
| InChI | InChI=1S/C19H24F2N2O2/c1-11(2)10-23-13(4)16(12(3)22-23)9-19(24)25-14(5)17-8-15(20)6-7-18(17)21/h6-8,11,14H,9-10H2,1-5H3 |
| InChIKey | ACSVKDKZYRQWBO-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 44.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 350.41 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-(2,5-difluorophenyl)ethyl 2-[3,5-dimethyl-1-(2-methylpropyl)pyrazol-4-yl]acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(2,5-difluorophenyl)ethyl 2-[3,5-dimethyl-1-(2-methylpropyl)pyrazol-4-yl]acetate?
The IUPAC name of 1-(2,5-difluorophenyl)ethyl 2-[3,5-dimethyl-1-(2-methylpropyl)pyrazol-4-yl]acetate (CID 55909252) is 1-(2,5-difluorophenyl)ethyl 2-[3,5-dimethyl-1-(2-methylpropyl)pyrazol-4-yl]acetate.
What is the SMILES notation for 1-(2,5-difluorophenyl)ethyl 2-[3,5-dimethyl-1-(2-methylpropyl)pyrazol-4-yl]acetate?
The canonical SMILES for 1-(2,5-difluorophenyl)ethyl 2-[3,5-dimethyl-1-(2-methylpropyl)pyrazol-4-yl]acetate is Cc1nn(CC(C)C)c(C)c1CC(=O)OC(C)c1cc(F)ccc1F.
What is the InChIKey of 1-(2,5-difluorophenyl)ethyl 2-[3,5-dimethyl-1-(2-methylpropyl)pyrazol-4-yl]acetate?
The InChIKey is ACSVKDKZYRQWBO-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H24F2N2O2/c1-11(2)10-23-13(4)16(12(3)22-23)9-19(24)25-14(5)17-8-15(20)6-7-18(17)21/h6-8,11,14H,9-10H2,1-5H3.
What are the key properties of 1-(2,5-difluorophenyl)ethyl 2-[3,5-dimethyl-1-(2-methylpropyl)pyrazol-4-yl]acetate?
1-(2,5-difluorophenyl)ethyl 2-[3,5-dimethyl-1-(2-methylpropyl)pyrazol-4-yl]acetate has a molecular weight of 350.41 g/mol, XLogP of 4.28, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2,5-difluorophenyl)ethyl 2-[3,5-dimethyl-1-(2-methylpropyl)pyrazol-4-yl]acetate is sourced from PubChem (CID 55909252), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).