C21H23FN2O3 — CID 55909662
N-(2,3-dihydro-1,4-benzodioxin-3-ylmethyl)-2-[(2-fluorophenyl)methyl-prop-2-enylamino]acetamide (PubChem CID 55909662) has the molecular formula C21H23FN2O3 and a molecular weight of 370.42 g/mol. Its IUPAC name is N-(2,3-dihydro-1,4-benzodioxin-3-ylmethyl)-2-[(2-fluorophenyl)methyl-prop-2-enylamino]acetamide.
| Compound Name | N-(2,3-dihydro-1,4-benzodioxin-3-ylmethyl)-2-[(2-fluorophenyl)methyl-prop-2-enylamino]acetamide |
|---|---|
| PubChem CID | 55909662 |
| Molecular Formula | C21H23FN2O3 |
| Molecular Weight | 370.42 g/mol |
| Exact Mass | 370.17 |
| IUPAC Name | N-(2,3-dihydro-1,4-benzodioxin-3-ylmethyl)-2-[(2-fluorophenyl)methyl-prop-2-enylamino]acetamide |
| SMILES | C=CCN(CC(=O)NCC1COc2ccccc2O1)Cc1ccccc1F |
| InChI | InChI=1S/C21H23FN2O3/c1-2-11-24(13-16-7-3-4-8-18(16)22)14-21(25)23-12-17-15-26-19-9-5-6-10-20(19)27-17/h2-10,17H,1,11-15H2,(H,23,25) |
| InChIKey | LHAORQXNJLBHOB-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.42 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|