About 6-ethyldeca-2,6-diene-4,5-diol
6-ethyldeca-2,6-diene-4,5-diol (PubChem CID 559110) has the molecular formula C12H22O2
and a molecular weight of 198.31 g/mol. Its IUPAC name is 6-ethyldeca-2,6-diene-4,5-diol.
Molecular Properties
| Compound Name | 6-ethyldeca-2,6-diene-4,5-diol |
| PubChem CID | 559110 |
| Molecular Formula | C12H22O2 |
| Molecular Weight | 198.31 g/mol |
| Exact Mass | 198.16 |
| IUPAC Name | 6-ethyldeca-2,6-diene-4,5-diol |
| SMILES | CC=CC(O)C(O)C(=CCCC)CC |
| InChI | InChI=1S/C12H22O2/c1-4-7-9-10(6-3)12(14)11(13)8-5-2/h5,8-9,11-14H,4,6-7H2,1-3H3 |
| InChIKey | RWSQJPCFDCSSBT-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 198.31 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 6-ethyldeca-2,6-diene-4,5-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-ethyldeca-2,6-diene-4,5-diol?
The IUPAC name of 6-ethyldeca-2,6-diene-4,5-diol (CID 559110) is 6-ethyldeca-2,6-diene-4,5-diol.
What is the SMILES notation for 6-ethyldeca-2,6-diene-4,5-diol?
The canonical SMILES for 6-ethyldeca-2,6-diene-4,5-diol is CC=CC(O)C(O)C(=CCCC)CC.
What is the InChIKey of 6-ethyldeca-2,6-diene-4,5-diol?
The InChIKey is RWSQJPCFDCSSBT-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H22O2/c1-4-7-9-10(6-3)12(14)11(13)8-5-2/h5,8-9,11-14H,4,6-7H2,1-3H3.
What are the key properties of 6-ethyldeca-2,6-diene-4,5-diol?
6-ethyldeca-2,6-diene-4,5-diol has a molecular weight of 198.31 g/mol, XLogP of 2.42, 6 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-ethyldeca-2,6-diene-4,5-diol is sourced from PubChem (CID 559110), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).