C18H13Cl2N3O2 — CID 55911404
3,5-dichloro-N-(2-oxo-3,4-dihydro-1H-quinolin-6-yl)-1H-indole-2-carboxamide (PubChem CID 55911404) has the molecular formula C18H13Cl2N3O2 and a molecular weight of 374.23 g/mol. Its IUPAC name is 3,5-dichloro-N-(2-oxo-3,4-dihydro-1H-quinolin-6-yl)-1H-indole-2-carboxamide.
| Compound Name | 3,5-dichloro-N-(2-oxo-3,4-dihydro-1H-quinolin-6-yl)-1H-indole-2-carboxamide |
|---|---|
| PubChem CID | 55911404 |
| Molecular Formula | C18H13Cl2N3O2 |
| Molecular Weight | 374.23 g/mol |
| Exact Mass | 373.04 |
| IUPAC Name | 3,5-dichloro-N-(2-oxo-3,4-dihydro-1H-quinolin-6-yl)-1H-indole-2-carboxamide |
| SMILES | O=C1CCc2cc(NC(=O)c3[nH]c4ccc(Cl)cc4c3Cl)ccc2N1 |
| InChI | InChI=1S/C18H13Cl2N3O2/c19-10-2-4-14-12(8-10)16(20)17(23-14)18(25)21-11-3-5-13-9(7-11)1-6-15(24)22-13/h2-5,7-8,23H,1,6H2,(H,21,25)(H,22,24) |
| InChIKey | WXVKIXVVWCXRDC-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 73.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.23 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |