C21H25ClN4O4 — CID 55912843
4-(4-chloro-2-nitrophenyl)-N-[3-(4-methoxyphenyl)propyl]piperazine-1-carboxamide (PubChem CID 55912843) has the molecular formula C21H25ClN4O4 and a molecular weight of 432.91 g/mol. Its IUPAC name is 4-(4-chloro-2-nitrophenyl)-N-[3-(4-methoxyphenyl)propyl]piperazine-1-carboxamide.
| Compound Name | 4-(4-chloro-2-nitrophenyl)-N-[3-(4-methoxyphenyl)propyl]piperazine-1-carboxamide |
|---|---|
| PubChem CID | 55912843 |
| Molecular Formula | C21H25ClN4O4 |
| Molecular Weight | 432.91 g/mol |
| Exact Mass | 432.16 |
| IUPAC Name | 4-(4-chloro-2-nitrophenyl)-N-[3-(4-methoxyphenyl)propyl]piperazine-1-carboxamide |
| SMILES | COc1ccc(CCCNC(=O)N2CCN(c3ccc(Cl)cc3[N+](=O)[O-])CC2)cc1 |
| InChI | InChI=1S/C21H25ClN4O4/c1-30-18-7-4-16(5-8-18)3-2-10-23-21(27)25-13-11-24(12-14-25)19-9-6-17(22)15-20(19)26(28)29/h4-9,15H,2-3,10-14H2,1H3,(H,23,27) |
| InChIKey | KGZSNSGLLHZTIE-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 87.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.91 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|