C19H25FN4O2 — CID 55913329
N-[1-(3-cyclopropyl-1,2,4-oxadiazol-5-yl)ethyl]-4-(2,6-dimethylmorpholin-4-yl)-3-fluoroaniline (PubChem CID 55913329) has the molecular formula C19H25FN4O2 and a molecular weight of 360.43 g/mol. Its IUPAC name is N-[1-(3-cyclopropyl-1,2,4-oxadiazol-5-yl)ethyl]-4-(2,6-dimethylmorpholin-4-yl)-3-fluoroaniline.
| Compound Name | N-[1-(3-cyclopropyl-1,2,4-oxadiazol-5-yl)ethyl]-4-(2,6-dimethylmorpholin-4-yl)-3-fluoroaniline |
|---|---|
| PubChem CID | 55913329 |
| Molecular Formula | C19H25FN4O2 |
| Molecular Weight | 360.43 g/mol |
| Exact Mass | 360.20 |
| IUPAC Name | N-[1-(3-cyclopropyl-1,2,4-oxadiazol-5-yl)ethyl]-4-(2,6-dimethylmorpholin-4-yl)-3-fluoroaniline |
| SMILES | CC1CN(c2ccc(NC(C)c3nc(C4CC4)no3)cc2F)CC(C)O1 |
| InChI | InChI=1S/C19H25FN4O2/c1-11-9-24(10-12(2)25-11)17-7-6-15(8-16(17)20)21-13(3)19-22-18(23-26-19)14-4-5-14/h6-8,11-14,21H,4-5,9-10H2,1-3H3 |
| InChIKey | JVDLKCQXFGPIOS-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 63.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.43 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|