About 4-methyl-2-prop-1-en-2-yl-4H-1,3-dithiine
4-methyl-2-prop-1-en-2-yl-4H-1,3-dithiine (PubChem CID 559143) has the molecular formula C8H12S2
and a molecular weight of 172.32 g/mol. Its IUPAC name is 4-methyl-2-prop-1-en-2-yl-4H-1,3-dithiine.
Molecular Properties
| Compound Name | 4-methyl-2-prop-1-en-2-yl-4H-1,3-dithiine |
| PubChem CID | 559143 |
| Molecular Formula | C8H12S2 |
| Molecular Weight | 172.32 g/mol |
| Exact Mass | 172.04 |
| IUPAC Name | 4-methyl-2-prop-1-en-2-yl-4H-1,3-dithiine |
| SMILES | C=C(C)C1SC=CC(C)S1 |
| InChI | InChI=1S/C8H12S2/c1-6(2)8-9-5-4-7(3)10-8/h4-5,7-8H,1H2,2-3H3 |
| InChIKey | NSPNUYVPTYGSOQ-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 172.32 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 4-methyl-2-prop-1-en-2-yl-4H-1,3-dithiine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methyl-2-prop-1-en-2-yl-4H-1,3-dithiine?
The IUPAC name of 4-methyl-2-prop-1-en-2-yl-4H-1,3-dithiine (CID 559143) is 4-methyl-2-prop-1-en-2-yl-4H-1,3-dithiine.
What is the SMILES notation for 4-methyl-2-prop-1-en-2-yl-4H-1,3-dithiine?
The canonical SMILES for 4-methyl-2-prop-1-en-2-yl-4H-1,3-dithiine is C=C(C)C1SC=CC(C)S1.
What is the InChIKey of 4-methyl-2-prop-1-en-2-yl-4H-1,3-dithiine?
The InChIKey is NSPNUYVPTYGSOQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H12S2/c1-6(2)8-9-5-4-7(3)10-8/h4-5,7-8H,1H2,2-3H3.
What are the key properties of 4-methyl-2-prop-1-en-2-yl-4H-1,3-dithiine?
4-methyl-2-prop-1-en-2-yl-4H-1,3-dithiine has a molecular weight of 172.32 g/mol, XLogP of 3.27, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methyl-2-prop-1-en-2-yl-4H-1,3-dithiine is sourced from PubChem (CID 559143), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).