About 2-(1-cyclohexa-1,3-dien-1-ylpropan-2-yloxy)oxane
2-(1-cyclohexa-1,3-dien-1-ylpropan-2-yloxy)oxane (PubChem CID 559157) has the molecular formula C14H22O2
and a molecular weight of 222.33 g/mol. Its IUPAC name is 2-(1-cyclohexa-1,3-dien-1-ylpropan-2-yloxy)oxane.
Molecular Properties
| Compound Name | 2-(1-cyclohexa-1,3-dien-1-ylpropan-2-yloxy)oxane |
| PubChem CID | 559157 |
| Molecular Formula | C14H22O2 |
| Molecular Weight | 222.33 g/mol |
| Exact Mass | 222.16 |
| IUPAC Name | 2-(1-cyclohexa-1,3-dien-1-ylpropan-2-yloxy)oxane |
| SMILES | CC(CC1=CC=CCC1)OC1CCCCO1 |
| InChI | InChI=1S/C14H22O2/c1-12(11-13-7-3-2-4-8-13)16-14-9-5-6-10-15-14/h2-3,7,12,14H,4-6,8-11H2,1H3 |
| InChIKey | NXSXCSYWKSDNQM-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 222.33 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-(1-cyclohexa-1,3-dien-1-ylpropan-2-yloxy)oxane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(1-cyclohexa-1,3-dien-1-ylpropan-2-yloxy)oxane?
The IUPAC name of 2-(1-cyclohexa-1,3-dien-1-ylpropan-2-yloxy)oxane (CID 559157) is 2-(1-cyclohexa-1,3-dien-1-ylpropan-2-yloxy)oxane.
What is the SMILES notation for 2-(1-cyclohexa-1,3-dien-1-ylpropan-2-yloxy)oxane?
The canonical SMILES for 2-(1-cyclohexa-1,3-dien-1-ylpropan-2-yloxy)oxane is CC(CC1=CC=CCC1)OC1CCCCO1.
What is the InChIKey of 2-(1-cyclohexa-1,3-dien-1-ylpropan-2-yloxy)oxane?
The InChIKey is NXSXCSYWKSDNQM-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H22O2/c1-12(11-13-7-3-2-4-8-13)16-14-9-5-6-10-15-14/h2-3,7,12,14H,4-6,8-11H2,1H3.
What are the key properties of 2-(1-cyclohexa-1,3-dien-1-ylpropan-2-yloxy)oxane?
2-(1-cyclohexa-1,3-dien-1-ylpropan-2-yloxy)oxane has a molecular weight of 222.33 g/mol, XLogP of 3.58, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1-cyclohexa-1,3-dien-1-ylpropan-2-yloxy)oxane is sourced from PubChem (CID 559157), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).