About 2,6-dimethyl-8-(oxan-2-yloxy)octa-2,6-dienal
2,6-dimethyl-8-(oxan-2-yloxy)octa-2,6-dienal (PubChem CID 559161) has the molecular formula C15H24O3
and a molecular weight of 252.35 g/mol. Its IUPAC name is 2,6-dimethyl-8-(oxan-2-yloxy)octa-2,6-dienal.
Molecular Properties
| Compound Name | 2,6-dimethyl-8-(oxan-2-yloxy)octa-2,6-dienal |
| PubChem CID | 559161 |
| Molecular Formula | C15H24O3 |
| Molecular Weight | 252.35 g/mol |
| Exact Mass | 252.17 |
| IUPAC Name | 2,6-dimethyl-8-(oxan-2-yloxy)octa-2,6-dienal |
| SMILES | CC(C=O)=CCCC(C)=CCOC1CCCCO1 |
| InChI | InChI=1S/C15H24O3/c1-13(6-5-7-14(2)12-16)9-11-18-15-8-3-4-10-17-15/h7,9,12,15H,3-6,8,10-11H2,1-2H3 |
| InChIKey | WYXVNCHVXOXVRH-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 252.35 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 2,6-dimethyl-8-(oxan-2-yloxy)octa-2,6-dienal with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,6-dimethyl-8-(oxan-2-yloxy)octa-2,6-dienal?
The IUPAC name of 2,6-dimethyl-8-(oxan-2-yloxy)octa-2,6-dienal (CID 559161) is 2,6-dimethyl-8-(oxan-2-yloxy)octa-2,6-dienal.
What is the SMILES notation for 2,6-dimethyl-8-(oxan-2-yloxy)octa-2,6-dienal?
The canonical SMILES for 2,6-dimethyl-8-(oxan-2-yloxy)octa-2,6-dienal is CC(C=O)=CCCC(C)=CCOC1CCCCO1.
What is the InChIKey of 2,6-dimethyl-8-(oxan-2-yloxy)octa-2,6-dienal?
The InChIKey is WYXVNCHVXOXVRH-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H24O3/c1-13(6-5-7-14(2)12-16)9-11-18-15-8-3-4-10-17-15/h7,9,12,15H,3-6,8,10-11H2,1-2H3.
What are the key properties of 2,6-dimethyl-8-(oxan-2-yloxy)octa-2,6-dienal?
2,6-dimethyl-8-(oxan-2-yloxy)octa-2,6-dienal has a molecular weight of 252.35 g/mol, XLogP of 3.40, 7 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2,6-dimethyl-8-(oxan-2-yloxy)octa-2,6-dienal is sourced from PubChem (CID 559161), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).