C19H20ClNO4 — CID 55916365
methyl 2-[4-[3-(2-chlorophenyl)propanoylamino]-3-methylphenoxy]acetate (PubChem CID 55916365) has the molecular formula C19H20ClNO4 and a molecular weight of 361.83 g/mol. Its IUPAC name is methyl 2-[4-[3-(2-chlorophenyl)propanoylamino]-3-methylphenoxy]acetate.
| Compound Name | methyl 2-[4-[3-(2-chlorophenyl)propanoylamino]-3-methylphenoxy]acetate |
|---|---|
| PubChem CID | 55916365 |
| Molecular Formula | C19H20ClNO4 |
| Molecular Weight | 361.83 g/mol |
| Exact Mass | 361.11 |
| IUPAC Name | methyl 2-[4-[3-(2-chlorophenyl)propanoylamino]-3-methylphenoxy]acetate |
| SMILES | COC(=O)COc1ccc(NC(=O)CCc2ccccc2Cl)c(C)c1 |
| InChI | InChI=1S/C19H20ClNO4/c1-13-11-15(25-12-19(23)24-2)8-9-17(13)21-18(22)10-7-14-5-3-4-6-16(14)20/h3-6,8-9,11H,7,10,12H2,1-2H3,(H,21,22) |
| InChIKey | BSUCSRUQQBNMBC-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.83 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |