C24H28N2O3 — CID 55917693
2-(2-acetyl-3,4-dihydro-1H-isoquinolin-1-yl)-N-[(4-methoxyphenyl)methyl]-N-prop-2-enylacetamide (PubChem CID 55917693) has the molecular formula C24H28N2O3 and a molecular weight of 392.50 g/mol. Its IUPAC name is 2-(2-acetyl-3,4-dihydro-1H-isoquinolin-1-yl)-N-[(4-methoxyphenyl)methyl]-N-prop-2-enylacetamide.
| Compound Name | 2-(2-acetyl-3,4-dihydro-1H-isoquinolin-1-yl)-N-[(4-methoxyphenyl)methyl]-N-prop-2-enylacetamide |
|---|---|
| PubChem CID | 55917693 |
| Molecular Formula | C24H28N2O3 |
| Molecular Weight | 392.50 g/mol |
| Exact Mass | 392.21 |
| IUPAC Name | 2-(2-acetyl-3,4-dihydro-1H-isoquinolin-1-yl)-N-[(4-methoxyphenyl)methyl]-N-prop-2-enylacetamide |
| SMILES | C=CCN(Cc1ccc(OC)cc1)C(=O)CC1c2ccccc2CCN1C(C)=O |
| InChI | InChI=1S/C24H28N2O3/c1-4-14-25(17-19-9-11-21(29-3)12-10-19)24(28)16-23-22-8-6-5-7-20(22)13-15-26(23)18(2)27/h4-12,23H,1,13-17H2,2-3H3 |
| InChIKey | DDHUWYRCZGKZKG-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.50 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|