C25H29N3O3S — CID 55918432
[2-(4-ethoxyphenyl)-4-methyl-1,3-thiazol-5-yl]-[4-(4-methoxyphenyl)-1,4-diazepan-1-yl]methanone (PubChem CID 55918432) has the molecular formula C25H29N3O3S and a molecular weight of 451.59 g/mol. Its IUPAC name is [2-(4-ethoxyphenyl)-4-methyl-1,3-thiazol-5-yl]-[4-(4-methoxyphenyl)-1,4-diazepan-1-yl]methanone.
| Compound Name | [2-(4-ethoxyphenyl)-4-methyl-1,3-thiazol-5-yl]-[4-(4-methoxyphenyl)-1,4-diazepan-1-yl]methanone |
|---|---|
| PubChem CID | 55918432 |
| Molecular Formula | C25H29N3O3S |
| Molecular Weight | 451.59 g/mol |
| Exact Mass | 451.19 |
| IUPAC Name | [2-(4-ethoxyphenyl)-4-methyl-1,3-thiazol-5-yl]-[4-(4-methoxyphenyl)-1,4-diazepan-1-yl]methanone |
| SMILES | CCOc1ccc(-c2nc(C)c(C(=O)N3CCCN(c4ccc(OC)cc4)CC3)s2)cc1 |
| InChI | InChI=1S/C25H29N3O3S/c1-4-31-22-10-6-19(7-11-22)24-26-18(2)23(32-24)25(29)28-15-5-14-27(16-17-28)20-8-12-21(30-3)13-9-20/h6-13H,4-5,14-17H2,1-3H3 |
| InChIKey | UXRUWXHLCGAXNF-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 54.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.59 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|