About 1-cyclohexyl-4,4-diethoxybutan-1-one
1-cyclohexyl-4,4-diethoxybutan-1-one (PubChem CID 559186) has the molecular formula C14H26O3
and a molecular weight of 242.36 g/mol. Its IUPAC name is 1-cyclohexyl-4,4-diethoxybutan-1-one.
Molecular Properties
| Compound Name | 1-cyclohexyl-4,4-diethoxybutan-1-one |
| PubChem CID | 559186 |
| Molecular Formula | C14H26O3 |
| Molecular Weight | 242.36 g/mol |
| Exact Mass | 242.19 |
| IUPAC Name | 1-cyclohexyl-4,4-diethoxybutan-1-one |
| SMILES | CCOC(CCC(=O)C1CCCCC1)OCC |
| InChI | InChI=1S/C14H26O3/c1-3-16-14(17-4-2)11-10-13(15)12-8-6-5-7-9-12/h12,14H,3-11H2,1-2H3 |
| InChIKey | YROGSDUHVYDAAA-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 242.36 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 1-cyclohexyl-4,4-diethoxybutan-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-cyclohexyl-4,4-diethoxybutan-1-one?
The IUPAC name of 1-cyclohexyl-4,4-diethoxybutan-1-one (CID 559186) is 1-cyclohexyl-4,4-diethoxybutan-1-one.
What is the SMILES notation for 1-cyclohexyl-4,4-diethoxybutan-1-one?
The canonical SMILES for 1-cyclohexyl-4,4-diethoxybutan-1-one is CCOC(CCC(=O)C1CCCCC1)OCC.
What is the InChIKey of 1-cyclohexyl-4,4-diethoxybutan-1-one?
The InChIKey is YROGSDUHVYDAAA-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H26O3/c1-3-16-14(17-4-2)11-10-13(15)12-8-6-5-7-9-12/h12,14H,3-11H2,1-2H3.
What are the key properties of 1-cyclohexyl-4,4-diethoxybutan-1-one?
1-cyclohexyl-4,4-diethoxybutan-1-one has a molecular weight of 242.36 g/mol, XLogP of 3.32, 8 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-cyclohexyl-4,4-diethoxybutan-1-one is sourced from PubChem (CID 559186), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).