C25H31N3O3 — CID 55918774
4-[4-(4-methoxyphenyl)-1,4-diazepane-1-carbonyl]-1-(2-phenylethyl)pyrrolidin-2-one (PubChem CID 55918774) has the molecular formula C25H31N3O3 and a molecular weight of 421.54 g/mol. Its IUPAC name is 4-[4-(4-methoxyphenyl)-1,4-diazepane-1-carbonyl]-1-(2-phenylethyl)pyrrolidin-2-one.
| Compound Name | 4-[4-(4-methoxyphenyl)-1,4-diazepane-1-carbonyl]-1-(2-phenylethyl)pyrrolidin-2-one |
|---|---|
| PubChem CID | 55918774 |
| Molecular Formula | C25H31N3O3 |
| Molecular Weight | 421.54 g/mol |
| Exact Mass | 421.24 |
| IUPAC Name | 4-[4-(4-methoxyphenyl)-1,4-diazepane-1-carbonyl]-1-(2-phenylethyl)pyrrolidin-2-one |
| SMILES | COc1ccc(N2CCCN(C(=O)C3CC(=O)N(CCc4ccccc4)C3)CC2)cc1 |
| InChI | InChI=1S/C25H31N3O3/c1-31-23-10-8-22(9-11-23)26-13-5-14-27(17-16-26)25(30)21-18-24(29)28(19-21)15-12-20-6-3-2-4-7-20/h2-4,6-11,21H,5,12-19H2,1H3 |
| InChIKey | AEAHQYLBKIKRQB-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 53.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.54 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|