C19H21N5O2S2 — CID 55919535
N-[4-[(4-methyl-1,3-thiazol-2-yl)sulfanyl]phenyl]-2-(3-oxo-6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-2-yl)acetamide (PubChem CID 55919535) has the molecular formula C19H21N5O2S2 and a molecular weight of 415.54 g/mol. Its IUPAC name is N-[4-[(4-methyl-1,3-thiazol-2-yl)sulfanyl]phenyl]-2-(3-oxo-6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-2-yl)acetamide.
| Compound Name | N-[4-[(4-methyl-1,3-thiazol-2-yl)sulfanyl]phenyl]-2-(3-oxo-6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-2-yl)acetamide |
|---|---|
| PubChem CID | 55919535 |
| Molecular Formula | C19H21N5O2S2 |
| Molecular Weight | 415.54 g/mol |
| Exact Mass | 415.11 |
| IUPAC Name | N-[4-[(4-methyl-1,3-thiazol-2-yl)sulfanyl]phenyl]-2-(3-oxo-6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-2-yl)acetamide |
| SMILES | Cc1csc(Sc2ccc(NC(=O)Cn3nc4n(c3=O)CCCCC4)cc2)n1 |
| InChI | InChI=1S/C19H21N5O2S2/c1-13-12-27-18(20-13)28-15-8-6-14(7-9-15)21-17(25)11-24-19(26)23-10-4-2-3-5-16(23)22-24/h6-9,12H,2-5,10-11H2,1H3,(H,21,25) |
| InChIKey | RKUMHJUSLLCQHX-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 81.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.54 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |