C18H19BrN2O4S — CID 55919720
N-[2-(3-bromophenoxy)ethyl]-4-(1,1-dioxo-1,2-thiazolidin-2-yl)benzamide (PubChem CID 55919720) has the molecular formula C18H19BrN2O4S and a molecular weight of 439.33 g/mol. Its IUPAC name is N-[2-(3-bromophenoxy)ethyl]-4-(1,1-dioxo-1,2-thiazolidin-2-yl)benzamide.
| Compound Name | N-[2-(3-bromophenoxy)ethyl]-4-(1,1-dioxo-1,2-thiazolidin-2-yl)benzamide |
|---|---|
| PubChem CID | 55919720 |
| Molecular Formula | C18H19BrN2O4S |
| Molecular Weight | 439.33 g/mol |
| Exact Mass | 438.02 |
| IUPAC Name | N-[2-(3-bromophenoxy)ethyl]-4-(1,1-dioxo-1,2-thiazolidin-2-yl)benzamide |
| SMILES | O=C(NCCOc1cccc(Br)c1)c1ccc(N2CCCS2(=O)=O)cc1 |
| InChI | InChI=1S/C18H19BrN2O4S/c19-15-3-1-4-17(13-15)25-11-9-20-18(22)14-5-7-16(8-6-14)21-10-2-12-26(21,23)24/h1,3-8,13H,2,9-12H2,(H,20,22) |
| InChIKey | IMWVMUNDZGVWAQ-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.33 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|