C23H29N3O5 — CID 55921387
methyl 2-methoxy-5-[[[3-(morpholin-4-ylmethyl)phenyl]methylcarbamoylamino]methyl]benzoate (PubChem CID 55921387) has the molecular formula C23H29N3O5 and a molecular weight of 427.50 g/mol. Its IUPAC name is methyl 2-methoxy-5-[[[3-(morpholin-4-ylmethyl)phenyl]methylcarbamoylamino]methyl]benzoate.
| Compound Name | methyl 2-methoxy-5-[[[3-(morpholin-4-ylmethyl)phenyl]methylcarbamoylamino]methyl]benzoate |
|---|---|
| PubChem CID | 55921387 |
| Molecular Formula | C23H29N3O5 |
| Molecular Weight | 427.50 g/mol |
| Exact Mass | 427.21 |
| IUPAC Name | methyl 2-methoxy-5-[[[3-(morpholin-4-ylmethyl)phenyl]methylcarbamoylamino]methyl]benzoate |
| SMILES | COC(=O)c1cc(CNC(=O)NCc2cccc(CN3CCOCC3)c2)ccc1OC |
| InChI | InChI=1S/C23H29N3O5/c1-29-21-7-6-18(13-20(21)22(27)30-2)15-25-23(28)24-14-17-4-3-5-19(12-17)16-26-8-10-31-11-9-26/h3-7,12-13H,8-11,14-16H2,1-2H3,(H2,24,25,28) |
| InChIKey | ZOBCVUOFPCCNCN-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 89.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.50 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |