C21H25N7 — CID 55922269
N,5-dimethyl-N-[5-(3-phenyl-1H-pyrazol-5-yl)pentyl]-[1,2,4]triazolo[1,5-a]pyrimidin-7-amine (PubChem CID 55922269) has the molecular formula C21H25N7 and a molecular weight of 375.48 g/mol. Its IUPAC name is N,5-dimethyl-N-[5-(3-phenyl-1H-pyrazol-5-yl)pentyl]-[1,2,4]triazolo[1,5-a]pyrimidin-7-amine.
| Compound Name | N,5-dimethyl-N-[5-(3-phenyl-1H-pyrazol-5-yl)pentyl]-[1,2,4]triazolo[1,5-a]pyrimidin-7-amine |
|---|---|
| PubChem CID | 55922269 |
| Molecular Formula | C21H25N7 |
| Molecular Weight | 375.48 g/mol |
| Exact Mass | 375.22 |
| IUPAC Name | N,5-dimethyl-N-[5-(3-phenyl-1H-pyrazol-5-yl)pentyl]-[1,2,4]triazolo[1,5-a]pyrimidin-7-amine |
| SMILES | Cc1cc(N(C)CCCCCc2cc(-c3ccccc3)n[nH]2)n2ncnc2n1 |
| InChI | InChI=1S/C21H25N7/c1-16-13-20(28-21(24-16)22-15-23-28)27(2)12-8-4-7-11-18-14-19(26-25-18)17-9-5-3-6-10-17/h3,5-6,9-10,13-15H,4,7-8,11-12H2,1-2H3,(H,25,26) |
| InChIKey | LJUNWIDOQSLQNT-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 75.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.48 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|