C21H23N5O5 — CID 55922798
N-(2-methyl-5-nitrophenyl)-2,4-dioxo-7-propan-2-yl-1-propylpyrido[2,3-d]pyrimidine-5-carboxamide (PubChem CID 55922798) has the molecular formula C21H23N5O5 and a molecular weight of 425.45 g/mol. Its IUPAC name is N-(2-methyl-5-nitrophenyl)-2,4-dioxo-7-propan-2-yl-1-propylpyrido[2,3-d]pyrimidine-5-carboxamide.
| Compound Name | N-(2-methyl-5-nitrophenyl)-2,4-dioxo-7-propan-2-yl-1-propylpyrido[2,3-d]pyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 55922798 |
| Molecular Formula | C21H23N5O5 |
| Molecular Weight | 425.45 g/mol |
| Exact Mass | 425.17 |
| IUPAC Name | N-(2-methyl-5-nitrophenyl)-2,4-dioxo-7-propan-2-yl-1-propylpyrido[2,3-d]pyrimidine-5-carboxamide |
| SMILES | CCCn1c(=O)[nH]c(=O)c2c(C(=O)Nc3cc([N+](=O)[O-])ccc3C)cc(C(C)C)nc21 |
| InChI | InChI=1S/C21H23N5O5/c1-5-8-25-18-17(20(28)24-21(25)29)14(10-15(22-18)11(2)3)19(27)23-16-9-13(26(30)31)7-6-12(16)4/h6-7,9-11H,5,8H2,1-4H3,(H,23,27)(H,24,28,29) |
| InChIKey | LVIIOSBBRJCEBD-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 139.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.45 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|