C18H30N2O5S — CID 55923975
2-(2-ethoxyethoxy)-N-[[4-(propan-2-ylsulfamoylmethyl)phenyl]methyl]propanamide (PubChem CID 55923975) has the molecular formula C18H30N2O5S and a molecular weight of 386.51 g/mol. Its IUPAC name is 2-(2-ethoxyethoxy)-N-[[4-(propan-2-ylsulfamoylmethyl)phenyl]methyl]propanamide.
| Compound Name | 2-(2-ethoxyethoxy)-N-[[4-(propan-2-ylsulfamoylmethyl)phenyl]methyl]propanamide |
|---|---|
| PubChem CID | 55923975 |
| Molecular Formula | C18H30N2O5S |
| Molecular Weight | 386.51 g/mol |
| Exact Mass | 386.19 |
| IUPAC Name | 2-(2-ethoxyethoxy)-N-[[4-(propan-2-ylsulfamoylmethyl)phenyl]methyl]propanamide |
| SMILES | CCOCCOC(C)C(=O)NCc1ccc(CS(=O)(=O)NC(C)C)cc1 |
| InChI | InChI=1S/C18H30N2O5S/c1-5-24-10-11-25-15(4)18(21)19-12-16-6-8-17(9-7-16)13-26(22,23)20-14(2)3/h6-9,14-15,20H,5,10-13H2,1-4H3,(H,19,21) |
| InChIKey | OAWMUCDLNCBMNT-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.51 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|