C21H22BrN5O2 — CID 55924073
4-bromo-N-[2-[[3-(imidazol-1-ylmethyl)phenyl]methylcarbamoylamino]ethyl]benzamide (PubChem CID 55924073) has the molecular formula C21H22BrN5O2 and a molecular weight of 456.34 g/mol. Its IUPAC name is 4-bromo-N-[2-[[3-(imidazol-1-ylmethyl)phenyl]methylcarbamoylamino]ethyl]benzamide.
| Compound Name | 4-bromo-N-[2-[[3-(imidazol-1-ylmethyl)phenyl]methylcarbamoylamino]ethyl]benzamide |
|---|---|
| PubChem CID | 55924073 |
| Molecular Formula | C21H22BrN5O2 |
| Molecular Weight | 456.34 g/mol |
| Exact Mass | 455.10 |
| IUPAC Name | 4-bromo-N-[2-[[3-(imidazol-1-ylmethyl)phenyl]methylcarbamoylamino]ethyl]benzamide |
| SMILES | O=C(NCCNC(=O)c1ccc(Br)cc1)NCc1cccc(Cn2ccnc2)c1 |
| InChI | InChI=1S/C21H22BrN5O2/c22-19-6-4-18(5-7-19)20(28)24-8-9-25-21(29)26-13-16-2-1-3-17(12-16)14-27-11-10-23-15-27/h1-7,10-12,15H,8-9,13-14H2,(H,24,28)(H2,25,26,29) |
| InChIKey | LGVXQWGZAQHQEQ-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 88.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.34 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|