C20H21F2NO — CID 55925127
N-cyclopropyl-3-(4-fluorophenyl)-N-[(2-fluorophenyl)methyl]butanamide (PubChem CID 55925127) has the molecular formula C20H21F2NO and a molecular weight of 329.39 g/mol. Its IUPAC name is N-cyclopropyl-3-(4-fluorophenyl)-N-[(2-fluorophenyl)methyl]butanamide.
| Compound Name | N-cyclopropyl-3-(4-fluorophenyl)-N-[(2-fluorophenyl)methyl]butanamide |
|---|---|
| PubChem CID | 55925127 |
| Molecular Formula | C20H21F2NO |
| Molecular Weight | 329.39 g/mol |
| Exact Mass | 329.16 |
| IUPAC Name | N-cyclopropyl-3-(4-fluorophenyl)-N-[(2-fluorophenyl)methyl]butanamide |
| SMILES | CC(CC(=O)N(Cc1ccccc1F)C1CC1)c1ccc(F)cc1 |
| InChI | InChI=1S/C20H21F2NO/c1-14(15-6-8-17(21)9-7-15)12-20(24)23(18-10-11-18)13-16-4-2-3-5-19(16)22/h2-9,14,18H,10-13H2,1H3 |
| InChIKey | QDFYJENWXLPRNM-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.39 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |