C18H15FIN3O2 — CID 55925235
3-[3-(3-fluoro-4-methylphenyl)-1,2,4-oxadiazol-5-yl]-N-(3-iodophenyl)propanamide (PubChem CID 55925235) has the molecular formula C18H15FIN3O2 and a molecular weight of 451.24 g/mol. Its IUPAC name is 3-[3-(3-fluoro-4-methylphenyl)-1,2,4-oxadiazol-5-yl]-N-(3-iodophenyl)propanamide.
| Compound Name | 3-[3-(3-fluoro-4-methylphenyl)-1,2,4-oxadiazol-5-yl]-N-(3-iodophenyl)propanamide |
|---|---|
| PubChem CID | 55925235 |
| Molecular Formula | C18H15FIN3O2 |
| Molecular Weight | 451.24 g/mol |
| Exact Mass | 451.02 |
| IUPAC Name | 3-[3-(3-fluoro-4-methylphenyl)-1,2,4-oxadiazol-5-yl]-N-(3-iodophenyl)propanamide |
| SMILES | Cc1ccc(-c2noc(CCC(=O)Nc3cccc(I)c3)n2)cc1F |
| InChI | InChI=1S/C18H15FIN3O2/c1-11-5-6-12(9-15(11)19)18-22-17(25-23-18)8-7-16(24)21-14-4-2-3-13(20)10-14/h2-6,9-10H,7-8H2,1H3,(H,21,24) |
| InChIKey | JRGPXLUVNMCGNY-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 68.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.24 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|