C16H24N2O6S — CID 55927675
[1-oxo-1-(propan-2-ylamino)propan-2-yl] (2S)-2-[(4-methoxyphenyl)sulfonylamino]propanoate (PubChem CID 55927675) has the molecular formula C16H24N2O6S and a molecular weight of 372.44 g/mol. Its IUPAC name is [1-oxo-1-(propan-2-ylamino)propan-2-yl] (2S)-2-[(4-methoxyphenyl)sulfonylamino]propanoate.
| Compound Name | [1-oxo-1-(propan-2-ylamino)propan-2-yl] (2S)-2-[(4-methoxyphenyl)sulfonylamino]propanoate |
|---|---|
| PubChem CID | 55927675 |
| Molecular Formula | C16H24N2O6S |
| Molecular Weight | 372.44 g/mol |
| Exact Mass | 372.14 |
| IUPAC Name | [1-oxo-1-(propan-2-ylamino)propan-2-yl] (2S)-2-[(4-methoxyphenyl)sulfonylamino]propanoate |
| SMILES | COc1ccc(S(=O)(=O)N[C@@H](C)C(=O)OC(C)C(=O)NC(C)C)cc1 |
| InChI | InChI=1S/C16H24N2O6S/c1-10(2)17-15(19)12(4)24-16(20)11(3)18-25(21,22)14-8-6-13(23-5)7-9-14/h6-12,18H,1-5H3,(H,17,19)/t11-,12?/m0/s1 |
| InChIKey | ZMUNPMQVXKSCQR-PXYINDEMSA-N |
| XLogP | 0.82 |
| TPSA | 110.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.44 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |