C20H18FNO2 — CID 55928942
N-cyclopropyl-N-[(2-fluorophenyl)methyl]-5-methyl-1-benzofuran-2-carboxamide (PubChem CID 55928942) has the molecular formula C20H18FNO2 and a molecular weight of 323.37 g/mol. Its IUPAC name is N-cyclopropyl-N-[(2-fluorophenyl)methyl]-5-methyl-1-benzofuran-2-carboxamide.
| Compound Name | N-cyclopropyl-N-[(2-fluorophenyl)methyl]-5-methyl-1-benzofuran-2-carboxamide |
|---|---|
| PubChem CID | 55928942 |
| Molecular Formula | C20H18FNO2 |
| Molecular Weight | 323.37 g/mol |
| Exact Mass | 323.13 |
| IUPAC Name | N-cyclopropyl-N-[(2-fluorophenyl)methyl]-5-methyl-1-benzofuran-2-carboxamide |
| SMILES | Cc1ccc2oc(C(=O)N(Cc3ccccc3F)C3CC3)cc2c1 |
| InChI | InChI=1S/C20H18FNO2/c1-13-6-9-18-15(10-13)11-19(24-18)20(23)22(16-7-8-16)12-14-4-2-3-5-17(14)21/h2-6,9-11,16H,7-8,12H2,1H3 |
| InChIKey | JROOSYDNYMYMIL-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 33.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.37 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |