C21H17N3O2S2 — CID 55930290
N-[3-(thiophene-2-carbonylamino)phenyl]-1-(thiophen-2-ylmethyl)pyrrole-2-carboxamide (PubChem CID 55930290) has the molecular formula C21H17N3O2S2 and a molecular weight of 407.52 g/mol. Its IUPAC name is N-[3-(thiophene-2-carbonylamino)phenyl]-1-(thiophen-2-ylmethyl)pyrrole-2-carboxamide.
| Compound Name | N-[3-(thiophene-2-carbonylamino)phenyl]-1-(thiophen-2-ylmethyl)pyrrole-2-carboxamide |
|---|---|
| PubChem CID | 55930290 |
| Molecular Formula | C21H17N3O2S2 |
| Molecular Weight | 407.52 g/mol |
| Exact Mass | 407.08 |
| IUPAC Name | N-[3-(thiophene-2-carbonylamino)phenyl]-1-(thiophen-2-ylmethyl)pyrrole-2-carboxamide |
| SMILES | O=C(Nc1cccc(NC(=O)c2cccn2Cc2cccs2)c1)c1cccs1 |
| InChI | InChI=1S/C21H17N3O2S2/c25-20(18-8-2-10-24(18)14-17-7-3-11-27-17)22-15-5-1-6-16(13-15)23-21(26)19-9-4-12-28-19/h1-13H,14H2,(H,22,25)(H,23,26) |
| InChIKey | PNMMOIDNVPTYMA-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 63.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.52 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |