C19H24BrN3O2 — CID 55930745
1-(bicyclo[2.2.1]heptane-2-carbonyl)-N-(5-bromo-2-pyridinyl)piperidine-3-carboxamide (PubChem CID 55930745) has the molecular formula C19H24BrN3O2 and a molecular weight of 406.32 g/mol. Its IUPAC name is 1-(bicyclo[2.2.1]heptane-2-carbonyl)-N-(5-bromo-2-pyridinyl)piperidine-3-carboxamide.
| Compound Name | 1-(bicyclo[2.2.1]heptane-2-carbonyl)-N-(5-bromo-2-pyridinyl)piperidine-3-carboxamide |
|---|---|
| PubChem CID | 55930745 |
| Molecular Formula | C19H24BrN3O2 |
| Molecular Weight | 406.32 g/mol |
| Exact Mass | 405.11 |
| IUPAC Name | 1-(bicyclo[2.2.1]heptane-2-carbonyl)-N-(5-bromo-2-pyridinyl)piperidine-3-carboxamide |
| SMILES | O=C(Nc1ccc(Br)cn1)C1CCCN(C(=O)C2CC3CCC2C3)C1 |
| InChI | InChI=1S/C19H24BrN3O2/c20-15-5-6-17(21-10-15)22-18(24)14-2-1-7-23(11-14)19(25)16-9-12-3-4-13(16)8-12/h5-6,10,12-14,16H,1-4,7-9,11H2,(H,21,22,24) |
| InChIKey | UEMQRVCUELGFAY-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.32 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |