C23H17ClN4O2S2 — CID 55930796
3-[2-(8-chloro-1,3,4,5-tetrahydropyrido[4,3-b]indol-2-yl)-2-oxoethyl]-5-thiophen-2-ylthieno[2,3-d]pyrimidin-4-one (PubChem CID 55930796) has the molecular formula C23H17ClN4O2S2 and a molecular weight of 481.00 g/mol. Its IUPAC name is 3-[2-(8-chloro-1,3,4,5-tetrahydropyrido[4,3-b]indol-2-yl)-2-oxoethyl]-5-thiophen-2-ylthieno[2,3-d]pyrimidin-4-one.
| Compound Name | 3-[2-(8-chloro-1,3,4,5-tetrahydropyrido[4,3-b]indol-2-yl)-2-oxoethyl]-5-thiophen-2-ylthieno[2,3-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 55930796 |
| Molecular Formula | C23H17ClN4O2S2 |
| Molecular Weight | 481.00 g/mol |
| Exact Mass | 480.05 |
| IUPAC Name | 3-[2-(8-chloro-1,3,4,5-tetrahydropyrido[4,3-b]indol-2-yl)-2-oxoethyl]-5-thiophen-2-ylthieno[2,3-d]pyrimidin-4-one |
| SMILES | O=C(Cn1cnc2scc(-c3cccs3)c2c1=O)N1CCc2[nH]c3ccc(Cl)cc3c2C1 |
| InChI | InChI=1S/C23H17ClN4O2S2/c24-13-3-4-17-14(8-13)15-9-27(6-5-18(15)26-17)20(29)10-28-12-25-22-21(23(28)30)16(11-32-22)19-2-1-7-31-19/h1-4,7-8,11-12,26H,5-6,9-10H2 |
| InChIKey | HYRZROBUUNKDKQ-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 70.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.00 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|