C27H35N5O2 — CID 55931424
4-oxo-4-(5-phenyl-3,4-dihydropyrazol-2-yl)-N-[4-(4-phenylpiperazin-1-yl)butyl]butanamide (PubChem CID 55931424) has the molecular formula C27H35N5O2 and a molecular weight of 461.61 g/mol. Its IUPAC name is 4-oxo-4-(5-phenyl-3,4-dihydropyrazol-2-yl)-N-[4-(4-phenylpiperazin-1-yl)butyl]butanamide.
| Compound Name | 4-oxo-4-(5-phenyl-3,4-dihydropyrazol-2-yl)-N-[4-(4-phenylpiperazin-1-yl)butyl]butanamide |
|---|---|
| PubChem CID | 55931424 |
| Molecular Formula | C27H35N5O2 |
| Molecular Weight | 461.61 g/mol |
| Exact Mass | 461.28 |
| IUPAC Name | 4-oxo-4-(5-phenyl-3,4-dihydropyrazol-2-yl)-N-[4-(4-phenylpiperazin-1-yl)butyl]butanamide |
| SMILES | O=C(CCC(=O)N1CCC(c2ccccc2)=N1)NCCCCN1CCN(c2ccccc2)CC1 |
| InChI | InChI=1S/C27H35N5O2/c33-26(13-14-27(34)32-18-15-25(29-32)23-9-3-1-4-10-23)28-16-7-8-17-30-19-21-31(22-20-30)24-11-5-2-6-12-24/h1-6,9-12H,7-8,13-22H2,(H,28,33) |
| InChIKey | AKKNPORUIKECML-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 68.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.61 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|