C21H24BrN3O4 — CID 55932037
N-(5-bromo-2-pyridinyl)-1-[2-(2-phenoxyethoxy)acetyl]piperidine-4-carboxamide (PubChem CID 55932037) has the molecular formula C21H24BrN3O4 and a molecular weight of 462.34 g/mol. Its IUPAC name is N-(5-bromo-2-pyridinyl)-1-[2-(2-phenoxyethoxy)acetyl]piperidine-4-carboxamide.
| Compound Name | N-(5-bromo-2-pyridinyl)-1-[2-(2-phenoxyethoxy)acetyl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 55932037 |
| Molecular Formula | C21H24BrN3O4 |
| Molecular Weight | 462.34 g/mol |
| Exact Mass | 461.10 |
| IUPAC Name | N-(5-bromo-2-pyridinyl)-1-[2-(2-phenoxyethoxy)acetyl]piperidine-4-carboxamide |
| SMILES | O=C(Nc1ccc(Br)cn1)C1CCN(C(=O)COCCOc2ccccc2)CC1 |
| InChI | InChI=1S/C21H24BrN3O4/c22-17-6-7-19(23-14-17)24-21(27)16-8-10-25(11-9-16)20(26)15-28-12-13-29-18-4-2-1-3-5-18/h1-7,14,16H,8-13,15H2,(H,23,24,27) |
| InChIKey | LXMRAIGLZZYAOI-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 80.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.34 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|