C19H23N7OS — CID 55933445
2-[[4-(4-propan-2-ylphenyl)-1,2,4-triazol-3-yl]sulfanyl]-N-[2-(pyrimidin-2-ylamino)ethyl]acetamide (PubChem CID 55933445) has the molecular formula C19H23N7OS and a molecular weight of 397.51 g/mol. Its IUPAC name is 2-[[4-(4-propan-2-ylphenyl)-1,2,4-triazol-3-yl]sulfanyl]-N-[2-(pyrimidin-2-ylamino)ethyl]acetamide.
| Compound Name | 2-[[4-(4-propan-2-ylphenyl)-1,2,4-triazol-3-yl]sulfanyl]-N-[2-(pyrimidin-2-ylamino)ethyl]acetamide |
|---|---|
| PubChem CID | 55933445 |
| Molecular Formula | C19H23N7OS |
| Molecular Weight | 397.51 g/mol |
| Exact Mass | 397.17 |
| IUPAC Name | 2-[[4-(4-propan-2-ylphenyl)-1,2,4-triazol-3-yl]sulfanyl]-N-[2-(pyrimidin-2-ylamino)ethyl]acetamide |
| SMILES | CC(C)c1ccc(-n2cnnc2SCC(=O)NCCNc2ncccn2)cc1 |
| InChI | InChI=1S/C19H23N7OS/c1-14(2)15-4-6-16(7-5-15)26-13-24-25-19(26)28-12-17(27)20-10-11-23-18-21-8-3-9-22-18/h3-9,13-14H,10-12H2,1-2H3,(H,20,27)(H,21,22,23) |
| InChIKey | KMZOOXGXPODPQN-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 97.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.51 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|