About methyl 2-acetamidohexanoate
methyl 2-acetamidohexanoate (PubChem CID 559361) has the molecular formula C9H17NO3
and a molecular weight of 187.24 g/mol. Its IUPAC name is methyl 2-acetamidohexanoate.
Molecular Properties
| Compound Name | methyl 2-acetamidohexanoate |
| PubChem CID | 559361 |
| Molecular Formula | C9H17NO3 |
| Molecular Weight | 187.24 g/mol |
| Exact Mass | 187.12 |
| IUPAC Name | methyl 2-acetamidohexanoate |
| SMILES | CCCCC(NC(C)=O)C(=O)OC |
| InChI | InChI=1S/C9H17NO3/c1-4-5-6-8(9(12)13-3)10-7(2)11/h8H,4-6H2,1-3H3,(H,10,11) |
| InChIKey | HDPMAXFSLNFIOV-UHFFFAOYSA-N |
| XLogP | 0.85 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 187.24 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze methyl 2-acetamidohexanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-acetamidohexanoate?
The IUPAC name of methyl 2-acetamidohexanoate (CID 559361) is methyl 2-acetamidohexanoate.
What is the SMILES notation for methyl 2-acetamidohexanoate?
The canonical SMILES for methyl 2-acetamidohexanoate is CCCCC(NC(C)=O)C(=O)OC.
What is the InChIKey of methyl 2-acetamidohexanoate?
The InChIKey is HDPMAXFSLNFIOV-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H17NO3/c1-4-5-6-8(9(12)13-3)10-7(2)11/h8H,4-6H2,1-3H3,(H,10,11).
What are the key properties of methyl 2-acetamidohexanoate?
methyl 2-acetamidohexanoate has a molecular weight of 187.24 g/mol, XLogP of 0.85, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-acetamidohexanoate is sourced from PubChem (CID 559361), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).