About N-propylbutan-2-amine
N-propylbutan-2-amine (PubChem CID 559366) has the molecular formula C7H17N
and a molecular weight of 115.22 g/mol. Its IUPAC name is N-propylbutan-2-amine.
Molecular Properties
| Compound Name | N-propylbutan-2-amine |
| PubChem CID | 559366 |
| Molecular Formula | C7H17N |
| Molecular Weight | 115.22 g/mol |
| Exact Mass | 115.14 |
| IUPAC Name | N-propylbutan-2-amine |
| SMILES | CCCNC(C)CC |
| InChI | InChI=1S/C7H17N/c1-4-6-8-7(3)5-2/h7-8H,4-6H2,1-3H3 |
| InChIKey | QYNZYUUXSVZDJO-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 115.22 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze N-propylbutan-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-propylbutan-2-amine?
The IUPAC name of N-propylbutan-2-amine (CID 559366) is N-propylbutan-2-amine.
What is the SMILES notation for N-propylbutan-2-amine?
The canonical SMILES for N-propylbutan-2-amine is CCCNC(C)CC.
What is the InChIKey of N-propylbutan-2-amine?
The InChIKey is QYNZYUUXSVZDJO-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H17N/c1-4-6-8-7(3)5-2/h7-8H,4-6H2,1-3H3.
What are the key properties of N-propylbutan-2-amine?
N-propylbutan-2-amine has a molecular weight of 115.22 g/mol, XLogP of 1.78, 4 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-propylbutan-2-amine is sourced from PubChem (CID 559366), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).