C21H19N3O6S2 — CID 55937552
(3S)-N-(2-methoxy-5-nitrophenyl)-2-thiophen-2-ylsulfonyl-3,4-dihydro-1H-isoquinoline-3-carboxamide (PubChem CID 55937552) has the molecular formula C21H19N3O6S2 and a molecular weight of 473.53 g/mol. Its IUPAC name is (3S)-N-(2-methoxy-5-nitrophenyl)-2-thiophen-2-ylsulfonyl-3,4-dihydro-1H-isoquinoline-3-carboxamide.
| Compound Name | (3S)-N-(2-methoxy-5-nitrophenyl)-2-thiophen-2-ylsulfonyl-3,4-dihydro-1H-isoquinoline-3-carboxamide |
|---|---|
| PubChem CID | 55937552 |
| Molecular Formula | C21H19N3O6S2 |
| Molecular Weight | 473.53 g/mol |
| Exact Mass | 473.07 |
| IUPAC Name | (3S)-N-(2-methoxy-5-nitrophenyl)-2-thiophen-2-ylsulfonyl-3,4-dihydro-1H-isoquinoline-3-carboxamide |
| SMILES | COc1ccc([N+](=O)[O-])cc1NC(=O)[C@@H]1Cc2ccccc2CN1S(=O)(=O)c1cccs1 |
| InChI | InChI=1S/C21H19N3O6S2/c1-30-19-9-8-16(24(26)27)12-17(19)22-21(25)18-11-14-5-2-3-6-15(14)13-23(18)32(28,29)20-7-4-10-31-20/h2-10,12,18H,11,13H2,1H3,(H,22,25)/t18-/m0/s1 |
| InChIKey | NLMOUYOUEZLTBG-SFHVURJKSA-N |
| XLogP | 3.42 |
| TPSA | 118.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.53 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|