C20H30N4O4S — CID 55939164
N-[4-[[(2S)-1-(4-cyclopentylpiperazin-1-yl)-1-oxopropan-2-yl]sulfamoyl]phenyl]acetamide (PubChem CID 55939164) has the molecular formula C20H30N4O4S and a molecular weight of 422.55 g/mol. Its IUPAC name is N-[4-[[(2S)-1-(4-cyclopentylpiperazin-1-yl)-1-oxopropan-2-yl]sulfamoyl]phenyl]acetamide.
| Compound Name | N-[4-[[(2S)-1-(4-cyclopentylpiperazin-1-yl)-1-oxopropan-2-yl]sulfamoyl]phenyl]acetamide |
|---|---|
| PubChem CID | 55939164 |
| Molecular Formula | C20H30N4O4S |
| Molecular Weight | 422.55 g/mol |
| Exact Mass | 422.20 |
| IUPAC Name | N-[4-[[(2S)-1-(4-cyclopentylpiperazin-1-yl)-1-oxopropan-2-yl]sulfamoyl]phenyl]acetamide |
| SMILES | CC(=O)Nc1ccc(S(=O)(=O)N[C@@H](C)C(=O)N2CCN(C3CCCC3)CC2)cc1 |
| InChI | InChI=1S/C20H30N4O4S/c1-15(20(26)24-13-11-23(12-14-24)18-5-3-4-6-18)22-29(27,28)19-9-7-17(8-10-19)21-16(2)25/h7-10,15,18,22H,3-6,11-14H2,1-2H3,(H,21,25)/t15-/m0/s1 |
| InChIKey | AJHRTBYTXLTPCE-HNNXBMFYSA-N |
| XLogP | 1.40 |
| TPSA | 98.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.55 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |