C28H29N3O4 — CID 55941127
4-(4-acetyl-2-methoxyphenoxy)-N-[(1S)-1-(1H-benzimidazol-2-yl)-2-phenylethyl]butanamide (PubChem CID 55941127) has the molecular formula C28H29N3O4 and a molecular weight of 471.56 g/mol. Its IUPAC name is 4-(4-acetyl-2-methoxyphenoxy)-N-[(1S)-1-(1H-benzimidazol-2-yl)-2-phenylethyl]butanamide.
| Compound Name | 4-(4-acetyl-2-methoxyphenoxy)-N-[(1S)-1-(1H-benzimidazol-2-yl)-2-phenylethyl]butanamide |
|---|---|
| PubChem CID | 55941127 |
| Molecular Formula | C28H29N3O4 |
| Molecular Weight | 471.56 g/mol |
| Exact Mass | 471.22 |
| IUPAC Name | 4-(4-acetyl-2-methoxyphenoxy)-N-[(1S)-1-(1H-benzimidazol-2-yl)-2-phenylethyl]butanamide |
| SMILES | COc1cc(C(C)=O)ccc1OCCCC(=O)N[C@@H](Cc1ccccc1)c1nc2ccccc2[nH]1 |
| InChI | InChI=1S/C28H29N3O4/c1-19(32)21-14-15-25(26(18-21)34-2)35-16-8-13-27(33)29-24(17-20-9-4-3-5-10-20)28-30-22-11-6-7-12-23(22)31-28/h3-7,9-12,14-15,18,24H,8,13,16-17H2,1-2H3,(H,29,33)(H,30,31)/t24-/m0/s1 |
| InChIKey | LJXGXDJSYUUREX-DEOSSOPVSA-N |
| XLogP | 5.03 |
| TPSA | 93.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.56 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|