C21H21FN2O5 — CID 55942310
[2-(4-fluorophenyl)-1,3-oxazol-4-yl]methyl (2S)-2-(1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl)propanoate (PubChem CID 55942310) has the molecular formula C21H21FN2O5 and a molecular weight of 400.41 g/mol. Its IUPAC name is [2-(4-fluorophenyl)-1,3-oxazol-4-yl]methyl (2S)-2-(1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl)propanoate.
| Compound Name | [2-(4-fluorophenyl)-1,3-oxazol-4-yl]methyl (2S)-2-(1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl)propanoate |
|---|---|
| PubChem CID | 55942310 |
| Molecular Formula | C21H21FN2O5 |
| Molecular Weight | 400.41 g/mol |
| Exact Mass | 400.14 |
| IUPAC Name | [2-(4-fluorophenyl)-1,3-oxazol-4-yl]methyl (2S)-2-(1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl)propanoate |
| SMILES | C[C@@H](C(=O)OCc1coc(-c2ccc(F)cc2)n1)N1C(=O)C2CCCCC2C1=O |
| InChI | InChI=1S/C21H21FN2O5/c1-12(24-19(25)16-4-2-3-5-17(16)20(24)26)21(27)29-11-15-10-28-18(23-15)13-6-8-14(22)9-7-13/h6-10,12,16-17H,2-5,11H2,1H3/t12-,16?,17?/m0/s1 |
| InChIKey | BUKNZCBSPRWMQJ-CDEQTRAXSA-N |
| XLogP | 3.09 |
| TPSA | 89.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.41 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|